C7H6I2N2O — CID 67233713
2,4-diiodobenzohydrazide (PubChem CID 67233713) has the molecular formula C7H6I2N2O and a molecular weight of 387.95 g/mol. Its IUPAC name is 2,4-diiodobenzohydrazide.
| Compound Name | 2,4-diiodobenzohydrazide |
|---|---|
| PubChem CID | 67233713 |
| Molecular Formula | C7H6I2N2O |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.86 |
| IUPAC Name | 2,4-diiodobenzohydrazide |
| SMILES | NNC(=O)c1ccc(I)cc1I |
| InChI | InChI=1S/C7H6I2N2O/c8-4-1-2-5(6(9)3-4)7(12)11-10/h1-3H,10H2,(H,11,12) |
| InChIKey | VWXVFEGGLFDLRO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|