C8H7I2NO — CID 131072416
2,5-diiodo-N-methylbenzamide (PubChem CID 131072416) has the molecular formula C8H7I2NO and a molecular weight of 386.96 g/mol. Its IUPAC name is 2,5-diiodo-N-methylbenzamide.
| Compound Name | 2,5-diiodo-N-methylbenzamide |
|---|---|
| PubChem CID | 131072416 |
| Molecular Formula | C8H7I2NO |
| Molecular Weight | 386.96 g/mol |
| Exact Mass | 386.86 |
| IUPAC Name | 2,5-diiodo-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(I)ccc1I |
| InChI | InChI=1S/C8H7I2NO/c1-11-8(12)6-4-5(9)2-3-7(6)10/h2-4H,1H3,(H,11,12) |
| InChIKey | YWQSXDNBOQJYGF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.96 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|