C13H8FI2NO — CID 46495854
N-(4-fluorophenyl)-2,5-diiodobenzamide (PubChem CID 46495854) has the molecular formula C13H8FI2NO and a molecular weight of 467.02 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,5-diiodobenzamide.
| Compound Name | N-(4-fluorophenyl)-2,5-diiodobenzamide |
|---|---|
| PubChem CID | 46495854 |
| Molecular Formula | C13H8FI2NO |
| Molecular Weight | 467.02 g/mol |
| Exact Mass | 466.87 |
| IUPAC Name | N-(4-fluorophenyl)-2,5-diiodobenzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc(I)ccc1I |
| InChI | InChI=1S/C13H8FI2NO/c14-8-1-4-10(5-2-8)17-13(18)11-7-9(15)3-6-12(11)16/h1-7H,(H,17,18) |
| InChIKey | GTMVWMGJKKTQEQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.02 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|