C16H13FIN3O3 — CID 86878003
N-[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]-5-fluoro-2-iodobenzamide (PubChem CID 86878003) has the molecular formula C16H13FIN3O3 and a molecular weight of 441.20 g/mol. Its IUPAC name is N-[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]-5-fluoro-2-iodobenzamide.
| Compound Name | N-[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]-5-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 86878003 |
| Molecular Formula | C16H13FIN3O3 |
| Molecular Weight | 441.20 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | N-[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]-5-fluoro-2-iodobenzamide |
| SMILES | NC(=O)CNC(=O)c1ccc(NC(=O)c2cc(F)ccc2I)cc1 |
| InChI | InChI=1S/C16H13FIN3O3/c17-10-3-6-13(18)12(7-10)16(24)21-11-4-1-9(2-5-11)15(23)20-8-14(19)22/h1-7H,8H2,(H2,19,22)(H,20,23)(H,21,24) |
| InChIKey | ZMSDOMLTWXPGPG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|