C15H10F3NO3 — CID 153301739
4-[[2-(difluoromethyl)-5-fluorobenzoyl]amino]benzoic acid (PubChem CID 153301739) has the molecular formula C15H10F3NO3 and a molecular weight of 309.24 g/mol. Its IUPAC name is 4-[[2-(difluoromethyl)-5-fluorobenzoyl]amino]benzoic acid.
| Compound Name | 4-[[2-(difluoromethyl)-5-fluorobenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 153301739 |
| Molecular Formula | C15H10F3NO3 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-[[2-(difluoromethyl)-5-fluorobenzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cc(F)ccc2C(F)F)cc1 |
| InChI | InChI=1S/C15H10F3NO3/c16-9-3-6-11(13(17)18)12(7-9)14(20)19-10-4-1-8(2-5-10)15(21)22/h1-7,13H,(H,19,20)(H,21,22) |
| InChIKey | WCQFYGGTWQDUJF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |