C10H8F3IN2O2 — CID 171920509
5-iodo-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]benzamide (PubChem CID 171920509) has the molecular formula C10H8F3IN2O2 and a molecular weight of 372.08 g/mol. Its IUPAC name is 5-iodo-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]benzamide.
| Compound Name | 5-iodo-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 171920509 |
| Molecular Formula | C10H8F3IN2O2 |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 5-iodo-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]benzamide |
| SMILES | CNC(=O)c1cc(I)ccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8F3IN2O2/c1-15-8(17)6-4-5(14)2-3-7(6)16-9(18)10(11,12)13/h2-4H,1H3,(H,15,17)(H,16,18) |
| InChIKey | GTELVNYELHWJKI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|