C16H16F3IN4O2 — CID 167460052
2-[[2-(4-iodopyrazol-1-yl)-2-methylpropanoyl]amino]-N-methyl-5-(trifluoromethyl)benzamide (PubChem CID 167460052) has the molecular formula C16H16F3IN4O2 and a molecular weight of 480.23 g/mol. Its IUPAC name is 2-[[2-(4-iodopyrazol-1-yl)-2-methylpropanoyl]amino]-N-methyl-5-(trifluoromethyl)benzamide.
| Compound Name | 2-[[2-(4-iodopyrazol-1-yl)-2-methylpropanoyl]amino]-N-methyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 167460052 |
| Molecular Formula | C16H16F3IN4O2 |
| Molecular Weight | 480.23 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 2-[[2-(4-iodopyrazol-1-yl)-2-methylpropanoyl]amino]-N-methyl-5-(trifluoromethyl)benzamide |
| SMILES | CNC(=O)c1cc(C(F)(F)F)ccc1NC(=O)C(C)(C)n1cc(I)cn1 |
| InChI | InChI=1S/C16H16F3IN4O2/c1-15(2,24-8-10(20)7-22-24)14(26)23-12-5-4-9(16(17,18)19)6-11(12)13(25)21-3/h4-8H,1-3H3,(H,21,25)(H,23,26) |
| InChIKey | WAHFQUCWUTZQNJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|