C15H15F3IN3O3S — CID 167460050
2-(4-iodopyrazol-1-yl)-2-methyl-N-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 167460050) has the molecular formula C15H15F3IN3O3S and a molecular weight of 501.27 g/mol. Its IUPAC name is 2-(4-iodopyrazol-1-yl)-2-methyl-N-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(4-iodopyrazol-1-yl)-2-methyl-N-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 167460050 |
| Molecular Formula | C15H15F3IN3O3S |
| Molecular Weight | 501.27 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | 2-(4-iodopyrazol-1-yl)-2-methyl-N-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C(F)(F)F)cc1S(C)(=O)=O)n1cc(I)cn1 |
| InChI | InChI=1S/C15H15F3IN3O3S/c1-14(2,22-8-10(19)7-20-22)13(23)21-11-5-4-9(15(16,17)18)6-12(11)26(3,24)25/h4-8H,1-3H3,(H,21,23) |
| InChIKey | JISYWGHXKKHTJR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|