C11H7F3N4O3 — CID 66270274
2-(2H-triazole-4-carbonylamino)-5-(trifluoromethyl)benzoic acid (PubChem CID 66270274) has the molecular formula C11H7F3N4O3 and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-(2H-triazole-4-carbonylamino)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(2H-triazole-4-carbonylamino)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 66270274 |
| Molecular Formula | C11H7F3N4O3 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-(2H-triazole-4-carbonylamino)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1C(=O)O)c1cn[nH]n1 |
| InChI | InChI=1S/C11H7F3N4O3/c12-11(13,14)5-1-2-7(6(3-5)10(20)21)16-9(19)8-4-15-18-17-8/h1-4H,(H,16,19)(H,20,21)(H,15,17,18) |
| InChIKey | LFHLBSOIDQPKGH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |