C12H11N5O4 — CID 63283056
5-acetamido-2-(2H-triazole-4-carbonylamino)benzoic acid (PubChem CID 63283056) has the molecular formula C12H11N5O4 and a molecular weight of 289.25 g/mol. Its IUPAC name is 5-acetamido-2-(2H-triazole-4-carbonylamino)benzoic acid.
| Compound Name | 5-acetamido-2-(2H-triazole-4-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63283056 |
| Molecular Formula | C12H11N5O4 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 5-acetamido-2-(2H-triazole-4-carbonylamino)benzoic acid |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cn[nH]n2)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H11N5O4/c1-6(18)14-7-2-3-9(8(4-7)12(20)21)15-11(19)10-5-13-17-16-10/h2-5H,1H3,(H,14,18)(H,15,19)(H,20,21)(H,13,16,17) |
| InChIKey | GLSPHUOIFBDYKD-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |