C13H15N5O2 — CID 110475529
N-(5-acetamido-2-ethylphenyl)-2H-triazole-4-carboxamide (PubChem CID 110475529) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-(5-acetamido-2-ethylphenyl)-2H-triazole-4-carboxamide.
| Compound Name | N-(5-acetamido-2-ethylphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 110475529 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-(5-acetamido-2-ethylphenyl)-2H-triazole-4-carboxamide |
| SMILES | CCc1ccc(NC(C)=O)cc1NC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C13H15N5O2/c1-3-9-4-5-10(15-8(2)19)6-11(9)16-13(20)12-7-14-18-17-12/h4-7H,3H2,1-2H3,(H,15,19)(H,16,20)(H,14,17,18) |
| InChIKey | LKXDMAQJFZWUAF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |