C17H16F2N2O2 — CID 108797375
N-(5-acetamido-2-ethylphenyl)-2,4-difluorobenzamide (PubChem CID 108797375) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is N-(5-acetamido-2-ethylphenyl)-2,4-difluorobenzamide.
| Compound Name | N-(5-acetamido-2-ethylphenyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 108797375 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(5-acetamido-2-ethylphenyl)-2,4-difluorobenzamide |
| SMILES | CCc1ccc(NC(C)=O)cc1NC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H16F2N2O2/c1-3-11-4-6-13(20-10(2)22)9-16(11)21-17(23)14-7-5-12(18)8-15(14)19/h4-9H,3H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | JPTDWVQBLHQYIX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |