C28H25F2N5O3 — CID 70188641
2-acetamido-N-(4-aminophenyl)benzamide;N-(4-aminophenyl)-2,4-difluorobenzamide (PubChem CID 70188641) has the molecular formula C28H25F2N5O3 and a molecular weight of 517.54 g/mol. Its IUPAC name is 2-acetamido-N-(4-aminophenyl)benzamide;N-(4-aminophenyl)-2,4-difluorobenzamide.
| Compound Name | 2-acetamido-N-(4-aminophenyl)benzamide;N-(4-aminophenyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 70188641 |
| Molecular Formula | C28H25F2N5O3 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 2-acetamido-N-(4-aminophenyl)benzamide;N-(4-aminophenyl)-2,4-difluorobenzamide |
| SMILES | CC(=O)Nc1ccccc1C(=O)Nc1ccc(N)cc1.Nc1ccc(NC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H15N3O2.C13H10F2N2O/c1-10(19)17-14-5-3-2-4-13(14)15(20)18-12-8-6-11(16)7-9-12;14-8-1-6-11(12(15)7-8)13(18)17-10-4-2-9(16)3-5-10/h2-9H,16H2,1H3,(H,17,19)(H,18,20);1-7H,16H2,(H,17,18) |
| InChIKey | OGYFWBVRMNYPJG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|