C15H14F2N2O — CID 16785051
N-[2-(1-aminoethyl)phenyl]-2,4-difluorobenzamide (PubChem CID 16785051) has the molecular formula C15H14F2N2O and a molecular weight of 276.29 g/mol. Its IUPAC name is N-[2-(1-aminoethyl)phenyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-(1-aminoethyl)phenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 16785051 |
| Molecular Formula | C15H14F2N2O |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-[2-(1-aminoethyl)phenyl]-2,4-difluorobenzamide |
| SMILES | CC(N)c1ccccc1NC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H14F2N2O/c1-9(18)11-4-2-3-5-14(11)19-15(20)12-7-6-10(16)8-13(12)17/h2-9H,18H2,1H3,(H,19,20) |
| InChIKey | MPWQDNMDBNURCJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |