C10H8N4O3 — CID 62033868
4-(2H-triazole-4-carbonylamino)benzoic acid (PubChem CID 62033868) has the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. Its IUPAC name is 4-(2H-triazole-4-carbonylamino)benzoic acid.
| Compound Name | 4-(2H-triazole-4-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 62033868 |
| Molecular Formula | C10H8N4O3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 4-(2H-triazole-4-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cn[nH]n2)cc1 |
| InChI | InChI=1S/C10H8N4O3/c15-9(8-5-11-14-13-8)12-7-3-1-6(2-4-7)10(16)17/h1-5H,(H,12,15)(H,16,17)(H,11,13,14) |
| InChIKey | ZIYORJIEKNFQID-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |