C10H11N5O3S — CID 78969284
N-[4-(methylsulfamoyl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 78969284) has the molecular formula C10H11N5O3S and a molecular weight of 281.30 g/mol. Its IUPAC name is N-[4-(methylsulfamoyl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[4-(methylsulfamoyl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 78969284 |
| Molecular Formula | C10H11N5O3S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | N-[4-(methylsulfamoyl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)c2cn[nH]n2)cc1 |
| InChI | InChI=1S/C10H11N5O3S/c1-11-19(17,18)8-4-2-7(3-5-8)13-10(16)9-6-12-15-14-9/h2-6,11H,1H3,(H,13,16)(H,12,14,15) |
| InChIKey | NQAGYLWGRVXFLO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |