C13H12FN3O3S — CID 115497288
6-fluoro-N-[4-(methylsulfamoyl)phenyl]pyridine-2-carboxamide (PubChem CID 115497288) has the molecular formula C13H12FN3O3S and a molecular weight of 309.32 g/mol. Its IUPAC name is 6-fluoro-N-[4-(methylsulfamoyl)phenyl]pyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-[4-(methylsulfamoyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115497288 |
| Molecular Formula | C13H12FN3O3S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 6-fluoro-N-[4-(methylsulfamoyl)phenyl]pyridine-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)c2cccc(F)n2)cc1 |
| InChI | InChI=1S/C13H12FN3O3S/c1-15-21(19,20)10-7-5-9(6-8-10)16-13(18)11-3-2-4-12(14)17-11/h2-8,15H,1H3,(H,16,18) |
| InChIKey | HNMFJSUPPUSYCQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|