C10H8FN5OS — CID 82016550
N-(2-carbamothioyl-4-fluorophenyl)-2H-triazole-4-carboxamide (PubChem CID 82016550) has the molecular formula C10H8FN5OS and a molecular weight of 265.27 g/mol. Its IUPAC name is N-(2-carbamothioyl-4-fluorophenyl)-2H-triazole-4-carboxamide.
| Compound Name | N-(2-carbamothioyl-4-fluorophenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 82016550 |
| Molecular Formula | C10H8FN5OS |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | N-(2-carbamothioyl-4-fluorophenyl)-2H-triazole-4-carboxamide |
| SMILES | NC(=S)c1cc(F)ccc1NC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C10H8FN5OS/c11-5-1-2-7(6(3-5)9(12)18)14-10(17)8-4-13-16-15-8/h1-4H,(H2,12,18)(H,14,17)(H,13,15,16) |
| InChIKey | CRQDHTHCPZSKMA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|