C14H9Cl2FN2OS — CID 82683921
N-(2-carbamothioyl-4-fluorophenyl)-3,4-dichlorobenzamide (PubChem CID 82683921) has the molecular formula C14H9Cl2FN2OS and a molecular weight of 343.21 g/mol. Its IUPAC name is N-(2-carbamothioyl-4-fluorophenyl)-3,4-dichlorobenzamide.
| Compound Name | N-(2-carbamothioyl-4-fluorophenyl)-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 82683921 |
| Molecular Formula | C14H9Cl2FN2OS |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | N-(2-carbamothioyl-4-fluorophenyl)-3,4-dichlorobenzamide |
| SMILES | NC(=S)c1cc(F)ccc1NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2FN2OS/c15-10-3-1-7(5-11(10)16)14(20)19-12-4-2-8(17)6-9(12)13(18)21/h1-6H,(H2,18,21)(H,19,20) |
| InChIKey | AYURTWOBUUSDMW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|