C11H9NO7 — CID 20548798
5-(methylcarbamoyl)benzene-1,2,4-tricarboxylic acid (PubChem CID 20548798) has the molecular formula C11H9NO7 and a molecular weight of 267.19 g/mol. Its IUPAC name is 5-(methylcarbamoyl)benzene-1,2,4-tricarboxylic acid.
| Compound Name | 5-(methylcarbamoyl)benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 20548798 |
| Molecular Formula | C11H9NO7 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 5-(methylcarbamoyl)benzene-1,2,4-tricarboxylic acid |
| SMILES | CNC(=O)c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C11H9NO7/c1-12-8(13)4-2-6(10(16)17)7(11(18)19)3-5(4)9(14)15/h2-3H,1H3,(H,12,13)(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | SRBFTAFMKYSFEL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |