2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid

C9H9NO5 — CID 156852362

IUPAC2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid
SMILESCNC(=O)c1cc(O)cc(C(=O)O)c1O
InChIInChI=1S/C9H9NO5/c1-10-8(13)5-2-4(11)3-6(7(5)12)9(14)15/h2-3,11-12H,1H3,(H,10,13)(H,14,15)
InChIKeyGAAGUGVCXBTIOA-UHFFFAOYSA-N
MW211.17 g/mol
LogP0.16
Rot. Bonds2

About 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid

2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid (PubChem CID 156852362) has the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. Its IUPAC name is 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid.

Molecular Properties

Compound Name2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid
PubChem CID156852362
Molecular FormulaC9H9NO5
Molecular Weight211.17 g/mol
Exact Mass211.05
IUPAC Name2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid
SMILESCNC(=O)c1cc(O)cc(C(=O)O)c1O
InChIInChI=1S/C9H9NO5/c1-10-8(13)5-2-4(11)3-6(7(5)12)9(14)15/h2-3,11-12H,1H3,(H,10,13)(H,14,15)
InChIKeyGAAGUGVCXBTIOA-UHFFFAOYSA-N
XLogP0.16
TPSA106.86 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.17
LogP ≤ 50.16
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroquinone', 'substructure': 'N/A'}

Analyze 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid?
The IUPAC name of 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid (CID 156852362) is 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid.
What is the SMILES notation for 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid?
The canonical SMILES for 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid is CNC(=O)c1cc(O)cc(C(=O)O)c1O.
What is the InChIKey of 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid?
The InChIKey is GAAGUGVCXBTIOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO5/c1-10-8(13)5-2-4(11)3-6(7(5)12)9(14)15/h2-3,11-12H,1H3,(H,10,13)(H,14,15).
What are the key properties of 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid?
2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid has a molecular weight of 211.17 g/mol, XLogP of 0.16, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid is sourced from PubChem (CID 156852362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).