C9H9NO5 — CID 156852362
2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid (PubChem CID 156852362) has the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. Its IUPAC name is 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid.
| Compound Name | 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 156852362 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 2,5-dihydroxy-3-(methylcarbamoyl)benzoic acid |
| SMILES | CNC(=O)c1cc(O)cc(C(=O)O)c1O |
| InChI | InChI=1S/C9H9NO5/c1-10-8(13)5-2-4(11)3-6(7(5)12)9(14)15/h2-3,11-12H,1H3,(H,10,13)(H,14,15) |
| InChIKey | GAAGUGVCXBTIOA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|