C24H21NO12 — CID 156760862
3-[[bis[(3-carboxy-2,5-dihydroxyphenyl)methyl]amino]methyl]-2,5-dihydroxybenzoic acid (PubChem CID 156760862) has the molecular formula C24H21NO12 and a molecular weight of 515.43 g/mol. Its IUPAC name is 3-[[bis[(3-carboxy-2,5-dihydroxyphenyl)methyl]amino]methyl]-2,5-dihydroxybenzoic acid.
| Compound Name | 3-[[bis[(3-carboxy-2,5-dihydroxyphenyl)methyl]amino]methyl]-2,5-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 156760862 |
| Molecular Formula | C24H21NO12 |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 3-[[bis[(3-carboxy-2,5-dihydroxyphenyl)methyl]amino]methyl]-2,5-dihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)cc(CN(Cc2cc(O)cc(C(=O)O)c2O)Cc2cc(O)cc(C(=O)O)c2O)c1O |
| InChI | InChI=1S/C24H21NO12/c26-13-1-10(19(29)16(4-13)22(32)33)7-25(8-11-2-14(27)5-17(20(11)30)23(34)35)9-12-3-15(28)6-18(21(12)31)24(36)37/h1-6,26-31H,7-9H2,(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | MYZXZFHIUSRKMU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 236.52 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|