C15H13NO7 — CID 175330861
3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid (PubChem CID 175330861) has the molecular formula C15H13NO7 and a molecular weight of 319.27 g/mol. Its IUPAC name is 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid.
| Compound Name | 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 175330861 |
| Molecular Formula | C15H13NO7 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid |
| SMILES | CN(C(=O)c1cc(O)cc(C(=O)O)c1O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H13NO7/c1-16(7-2-8(17)4-9(18)3-7)14(21)11-5-10(19)6-12(13(11)20)15(22)23/h2-6,17-20H,1H3,(H,22,23) |
| InChIKey | SHWRTTFKNHUXNB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|