About 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid
3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid (PubChem CID 175330861) has the molecular formula C15H13NO7
and a molecular weight of 319.27 g/mol. Its IUPAC name is 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid.
Molecular Properties
| Compound Name | 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid |
| PubChem CID | 175330861 |
| Molecular Formula | C15H13NO7 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid |
| SMILES | CN(C(=O)c1cc(O)cc(C(=O)O)c1O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H13NO7/c1-16(7-2-8(17)4-9(18)3-7)14(21)11-5-10(19)6-12(13(11)20)15(22)23/h2-6,17-20H,1H3,(H,22,23) |
| InChIKey | SHWRTTFKNHUXNB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid?
The IUPAC name of 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid (CID 175330861) is 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid.
What is the SMILES notation for 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid?
The canonical SMILES for 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid is CN(C(=O)c1cc(O)cc(C(=O)O)c1O)c1cc(O)cc(O)c1.
What is the InChIKey of 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid?
The InChIKey is SHWRTTFKNHUXNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO7/c1-16(7-2-8(17)4-9(18)3-7)14(21)11-5-10(19)6-12(13(11)20)15(22)23/h2-6,17-20H,1H3,(H,22,23).
What are the key properties of 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid?
3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid has a molecular weight of 319.27 g/mol, XLogP of 1.48, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dihydroxyphenyl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid is sourced from PubChem (CID 175330861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).