C15H15NO8 — CID 175384348
3-[(4,5-dihydroxy-3-oxocyclohexen-1-yl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid (PubChem CID 175384348) has the molecular formula C15H15NO8 and a molecular weight of 337.28 g/mol. Its IUPAC name is 3-[(4,5-dihydroxy-3-oxocyclohexen-1-yl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid.
| Compound Name | 3-[(4,5-dihydroxy-3-oxocyclohexen-1-yl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 175384348 |
| Molecular Formula | C15H15NO8 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-[(4,5-dihydroxy-3-oxocyclohexen-1-yl)-methylcarbamoyl]-2,5-dihydroxybenzoic acid |
| SMILES | CN(C(=O)c1cc(O)cc(C(=O)O)c1O)C1=CC(=O)C(O)C(O)C1 |
| InChI | InChI=1S/C15H15NO8/c1-16(6-2-10(18)13(21)11(19)3-6)14(22)8-4-7(17)5-9(12(8)20)15(23)24/h2,4-5,11,13,17,19-21H,3H2,1H3,(H,23,24) |
| InChIKey | SDABPGDMMTYSFX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|