C24H20N2O6 — CID 118520306
5-[3-carboxy-4-[(4-methylphenyl)carbamoyl]phenyl]-2-(methylcarbamoyl)benzoic acid (PubChem CID 118520306) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is 5-[3-carboxy-4-[(4-methylphenyl)carbamoyl]phenyl]-2-(methylcarbamoyl)benzoic acid.
| Compound Name | 5-[3-carboxy-4-[(4-methylphenyl)carbamoyl]phenyl]-2-(methylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 118520306 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 5-[3-carboxy-4-[(4-methylphenyl)carbamoyl]phenyl]-2-(methylcarbamoyl)benzoic acid |
| SMILES | CNC(=O)c1ccc(-c2ccc(C(=O)Nc3ccc(C)cc3)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C24H20N2O6/c1-13-3-7-16(8-4-13)26-22(28)18-10-6-15(12-20(18)24(31)32)14-5-9-17(21(27)25-2)19(11-14)23(29)30/h3-12H,1-2H3,(H,25,27)(H,26,28)(H,29,30)(H,31,32) |
| InChIKey | JWSKLORBAIFQJF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |