C31H28N2O6 — CID 20733287
2-[[4-[[4-[(2-carboxy-4-methylanilino)oxymethyl]phenyl]methyl]phenyl]carbamoyl]-5-methylbenzoic acid (PubChem CID 20733287) has the molecular formula C31H28N2O6 and a molecular weight of 524.57 g/mol. Its IUPAC name is 2-[[4-[[4-[(2-carboxy-4-methylanilino)oxymethyl]phenyl]methyl]phenyl]carbamoyl]-5-methylbenzoic acid.
| Compound Name | 2-[[4-[[4-[(2-carboxy-4-methylanilino)oxymethyl]phenyl]methyl]phenyl]carbamoyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 20733287 |
| Molecular Formula | C31H28N2O6 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 2-[[4-[[4-[(2-carboxy-4-methylanilino)oxymethyl]phenyl]methyl]phenyl]carbamoyl]-5-methylbenzoic acid |
| SMILES | Cc1ccc(NOCc2ccc(Cc3ccc(NC(=O)c4ccc(C)cc4C(=O)O)cc3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C31H28N2O6/c1-19-3-13-25(26(15-19)30(35)36)29(34)32-24-11-9-22(10-12-24)17-21-5-7-23(8-6-21)18-39-33-28-14-4-20(2)16-27(28)31(37)38/h3-16,33H,17-18H2,1-2H3,(H,32,34)(H,35,36)(H,37,38) |
| InChIKey | OHVAJNIGQMIONP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|