C31H30N2O6 — CID 159699815
formaldehyde;2-[[4-[[4-[2-(hydroperoxymethyl)-5-methylanilino]phenyl]methyl]phenyl]carbamoyl]-4-methylbenzoic acid (PubChem CID 159699815) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is formaldehyde;2-[[4-[[4-[2-(hydroperoxymethyl)-5-methylanilino]phenyl]methyl]phenyl]carbamoyl]-4-methylbenzoic acid.
| Compound Name | formaldehyde;2-[[4-[[4-[2-(hydroperoxymethyl)-5-methylanilino]phenyl]methyl]phenyl]carbamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 159699815 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | formaldehyde;2-[[4-[[4-[2-(hydroperoxymethyl)-5-methylanilino]phenyl]methyl]phenyl]carbamoyl]-4-methylbenzoic acid |
| SMILES | C=O.Cc1ccc(COO)c(Nc2ccc(Cc3ccc(NC(=O)c4cc(C)ccc4C(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C30H28N2O5.CH2O/c1-19-4-14-26(30(34)35)27(15-19)29(33)32-25-12-7-22(8-13-25)17-21-5-10-24(11-6-21)31-28-16-20(2)3-9-23(28)18-37-36;1-2/h3-16,31,36H,17-18H2,1-2H3,(H,32,33)(H,34,35);1H2 |
| InChIKey | MXLZUSJLAJFGEG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|