C33H33N3O8 — CID 59936103
2-[[4-[[3-ethyl-4-[[2-(hydroperoxymethyl)-5-nitrophenyl]methoxyamino]phenyl]methyl]-2-methylphenyl]carbamoyl]-4-methylbenzoic acid (PubChem CID 59936103) has the molecular formula C33H33N3O8 and a molecular weight of 599.64 g/mol. Its IUPAC name is 2-[[4-[[3-ethyl-4-[[2-(hydroperoxymethyl)-5-nitrophenyl]methoxyamino]phenyl]methyl]-2-methylphenyl]carbamoyl]-4-methylbenzoic acid.
| Compound Name | 2-[[4-[[3-ethyl-4-[[2-(hydroperoxymethyl)-5-nitrophenyl]methoxyamino]phenyl]methyl]-2-methylphenyl]carbamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 59936103 |
| Molecular Formula | C33H33N3O8 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | 2-[[4-[[3-ethyl-4-[[2-(hydroperoxymethyl)-5-nitrophenyl]methoxyamino]phenyl]methyl]-2-methylphenyl]carbamoyl]-4-methylbenzoic acid |
| SMILES | CCc1cc(Cc2ccc(NC(=O)c3cc(C)ccc3C(=O)O)c(C)c2)ccc1NOCc1cc([N+](=O)[O-])ccc1COO |
| InChI | InChI=1S/C33H33N3O8/c1-4-24-16-23(7-12-31(24)35-43-18-26-17-27(36(40)41)9-8-25(26)19-44-42)15-22-6-11-30(21(3)14-22)34-32(37)29-13-20(2)5-10-28(29)33(38)39/h5-14,16-17,35,42H,4,15,18-19H2,1-3H3,(H,34,37)(H,38,39) |
| InChIKey | DBLNAIVWUZRADB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 160.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|