C38H36N2O6 — CID 59935685
4-benzyl-2-[[4-[[[5-benzyl-2-(hydroperoxymethyl)phenyl]methoxyamino]methyl]phenyl]methylcarbamoyl]benzoic acid (PubChem CID 59935685) has the molecular formula C38H36N2O6 and a molecular weight of 616.71 g/mol. Its IUPAC name is 4-benzyl-2-[[4-[[[5-benzyl-2-(hydroperoxymethyl)phenyl]methoxyamino]methyl]phenyl]methylcarbamoyl]benzoic acid.
| Compound Name | 4-benzyl-2-[[4-[[[5-benzyl-2-(hydroperoxymethyl)phenyl]methoxyamino]methyl]phenyl]methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 59935685 |
| Molecular Formula | C38H36N2O6 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 4-benzyl-2-[[4-[[[5-benzyl-2-(hydroperoxymethyl)phenyl]methoxyamino]methyl]phenyl]methylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cc2ccccc2)cc1C(=O)NCc1ccc(CNOCc2cc(Cc3ccccc3)ccc2COO)cc1 |
| InChI | InChI=1S/C38H36N2O6/c41-37(36-22-32(16-18-35(36)38(42)43)20-28-9-5-2-6-10-28)39-23-29-11-13-30(14-12-29)24-40-45-25-34-21-31(15-17-33(34)26-46-44)19-27-7-3-1-4-8-27/h1-18,21-22,40,44H,19-20,23-26H2,(H,39,41)(H,42,43) |
| InChIKey | DEKINAWCDPIQLA-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|