C42H32Cl2O8 — CID 59935705
4-benzyl-2-[4-[4-[[5-benzyl-2-(hydroperoxymethyl)phenyl]methylperoxy]-3-chlorophenyl]-2-chlorophenoxy]carbonylbenzoic acid (PubChem CID 59935705) has the molecular formula C42H32Cl2O8 and a molecular weight of 735.62 g/mol. Its IUPAC name is 4-benzyl-2-[4-[4-[[5-benzyl-2-(hydroperoxymethyl)phenyl]methylperoxy]-3-chlorophenyl]-2-chlorophenoxy]carbonylbenzoic acid.
| Compound Name | 4-benzyl-2-[4-[4-[[5-benzyl-2-(hydroperoxymethyl)phenyl]methylperoxy]-3-chlorophenyl]-2-chlorophenoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 59935705 |
| Molecular Formula | C42H32Cl2O8 |
| Molecular Weight | 735.62 g/mol |
| Exact Mass | 734.15 |
| IUPAC Name | 4-benzyl-2-[4-[4-[[5-benzyl-2-(hydroperoxymethyl)phenyl]methylperoxy]-3-chlorophenyl]-2-chlorophenoxy]carbonylbenzoic acid |
| SMILES | O=C(O)c1ccc(Cc2ccccc2)cc1C(=O)Oc1ccc(-c2ccc(OOCc3cc(Cc4ccccc4)ccc3COO)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C42H32Cl2O8/c43-37-23-31(14-17-39(37)51-42(47)36-22-30(12-16-35(36)41(45)46)20-28-9-5-2-6-10-28)32-15-18-40(38(44)24-32)52-50-26-34-21-29(11-13-33(34)25-49-48)19-27-7-3-1-4-8-27/h1-18,21-24,48H,19-20,25-26H2,(H,45,46) |
| InChIKey | ALYSCFNIZSCQKP-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.62 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|