C45H40O8 — CID 91511987
5-benzyl-2-[4-[2-[4-[4-benzyl-2-(hydroperoxymethyl)phenoxy]phenyl]propan-2-yl]phenoxy]carbonylbenzoic acid;formaldehyde (PubChem CID 91511987) has the molecular formula C45H40O8 and a molecular weight of 708.81 g/mol. Its IUPAC name is 5-benzyl-2-[4-[2-[4-[4-benzyl-2-(hydroperoxymethyl)phenoxy]phenyl]propan-2-yl]phenoxy]carbonylbenzoic acid;formaldehyde.
| Compound Name | 5-benzyl-2-[4-[2-[4-[4-benzyl-2-(hydroperoxymethyl)phenoxy]phenyl]propan-2-yl]phenoxy]carbonylbenzoic acid;formaldehyde |
|---|---|
| PubChem CID | 91511987 |
| Molecular Formula | C45H40O8 |
| Molecular Weight | 708.81 g/mol |
| Exact Mass | 708.27 |
| IUPAC Name | 5-benzyl-2-[4-[2-[4-[4-benzyl-2-(hydroperoxymethyl)phenoxy]phenyl]propan-2-yl]phenoxy]carbonylbenzoic acid;formaldehyde |
| SMILES | C=O.CC(C)(c1ccc(OC(=O)c2ccc(Cc3ccccc3)cc2C(=O)O)cc1)c1ccc(Oc2ccc(Cc3ccccc3)cc2COO)cc1 |
| InChI | InChI=1S/C44H38O7.CH2O/c1-44(2,35-15-19-37(20-16-35)50-41-24-14-32(27-34(41)29-49-48)25-30-9-5-3-6-10-30)36-17-21-38(22-18-36)51-43(47)39-23-13-33(28-40(39)42(45)46)26-31-11-7-4-8-12-31;1-2/h3-24,27-28,48H,25-26,29H2,1-2H3,(H,45,46);1H2 |
| InChIKey | GMTZKAZRRQYFCI-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.81 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|