C41H34O11 — CID 20733076
2-[[4-[2-[4-(2-carboxy-4-ethynoxybenzoyl)oxyphenyl]propan-2-yl]phenyl]peroxymethyl]-5-(2-phenoxyethoxy)benzoic acid (PubChem CID 20733076) has the molecular formula C41H34O11 and a molecular weight of 702.71 g/mol. Its IUPAC name is 2-[[4-[2-[4-(2-carboxy-4-ethynoxybenzoyl)oxyphenyl]propan-2-yl]phenyl]peroxymethyl]-5-(2-phenoxyethoxy)benzoic acid.
| Compound Name | 2-[[4-[2-[4-(2-carboxy-4-ethynoxybenzoyl)oxyphenyl]propan-2-yl]phenyl]peroxymethyl]-5-(2-phenoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 20733076 |
| Molecular Formula | C41H34O11 |
| Molecular Weight | 702.71 g/mol |
| Exact Mass | 702.21 |
| IUPAC Name | 2-[[4-[2-[4-(2-carboxy-4-ethynoxybenzoyl)oxyphenyl]propan-2-yl]phenyl]peroxymethyl]-5-(2-phenoxyethoxy)benzoic acid |
| SMILES | C#COc1ccc(C(=O)Oc2ccc(C(C)(C)c3ccc(OOCc4ccc(OCCOc5ccccc5)cc4C(=O)O)cc3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C41H34O11/c1-4-47-33-20-21-35(37(25-33)39(44)45)40(46)51-31-16-11-28(12-17-31)41(2,3)29-13-18-32(19-14-29)52-50-26-27-10-15-34(24-36(27)38(42)43)49-23-22-48-30-8-6-5-7-9-30/h1,5-21,24-25H,22-23,26H2,2-3H3,(H,42,43)(H,44,45) |
| InChIKey | KEKKQBUFXFPWPH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.71 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|