C38H30N2O10 — CID 20733267
2-[[4-[4-[(2-carboxy-4-ethynoxybenzoyl)amino]phenoxy]anilino]oxymethyl]-5-(2-phenoxyethoxy)benzoic acid (PubChem CID 20733267) has the molecular formula C38H30N2O10 and a molecular weight of 674.66 g/mol. Its IUPAC name is 2-[[4-[4-[(2-carboxy-4-ethynoxybenzoyl)amino]phenoxy]anilino]oxymethyl]-5-(2-phenoxyethoxy)benzoic acid.
| Compound Name | 2-[[4-[4-[(2-carboxy-4-ethynoxybenzoyl)amino]phenoxy]anilino]oxymethyl]-5-(2-phenoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 20733267 |
| Molecular Formula | C38H30N2O10 |
| Molecular Weight | 674.66 g/mol |
| Exact Mass | 674.19 |
| IUPAC Name | 2-[[4-[4-[(2-carboxy-4-ethynoxybenzoyl)amino]phenoxy]anilino]oxymethyl]-5-(2-phenoxyethoxy)benzoic acid |
| SMILES | C#COc1ccc(C(=O)Nc2ccc(Oc3ccc(NOCc4ccc(OCCOc5ccccc5)cc4C(=O)O)cc3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C38H30N2O10/c1-2-46-31-18-19-33(35(23-31)38(44)45)36(41)39-26-9-14-29(15-10-26)50-30-16-11-27(12-17-30)40-49-24-25-8-13-32(22-34(25)37(42)43)48-21-20-47-28-6-4-3-5-7-28/h1,3-19,22-23,40H,20-21,24H2,(H,39,41)(H,42,43)(H,44,45) |
| InChIKey | TUAMWUPVDADPNO-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 161.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|