C32H34N2O9 — CID 20733404
2-[[6-[(2-carboxy-4-ethynoxybenzoyl)amino]hexylamino]oxymethyl]-5-(2-phenoxyethoxy)benzoic acid (PubChem CID 20733404) has the molecular formula C32H34N2O9 and a molecular weight of 590.63 g/mol. Its IUPAC name is 2-[[6-[(2-carboxy-4-ethynoxybenzoyl)amino]hexylamino]oxymethyl]-5-(2-phenoxyethoxy)benzoic acid.
| Compound Name | 2-[[6-[(2-carboxy-4-ethynoxybenzoyl)amino]hexylamino]oxymethyl]-5-(2-phenoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 20733404 |
| Molecular Formula | C32H34N2O9 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 2-[[6-[(2-carboxy-4-ethynoxybenzoyl)amino]hexylamino]oxymethyl]-5-(2-phenoxyethoxy)benzoic acid |
| SMILES | C#COc1ccc(C(=O)NCCCCCCNOCc2ccc(OCCOc3ccccc3)cc2C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C32H34N2O9/c1-2-40-25-14-15-27(29(21-25)32(38)39)30(35)33-16-8-3-4-9-17-34-43-22-23-12-13-26(20-28(23)31(36)37)42-19-18-41-24-10-6-5-7-11-24/h1,5-7,10-15,20-21,34H,3-4,8-9,16-19,22H2,(H,33,35)(H,36,37)(H,38,39) |
| InChIKey | YYBQNXJSVQFOJV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 152.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|