C28H24N2O9 — CID 59936011
2-[[4-[4-[[2-(hydroperoxymethyl)-4-hydroxyphenyl]methoxyamino]phenoxy]phenyl]carbamoyl]-5-hydroxybenzoic acid (PubChem CID 59936011) has the molecular formula C28H24N2O9 and a molecular weight of 532.51 g/mol. Its IUPAC name is 2-[[4-[4-[[2-(hydroperoxymethyl)-4-hydroxyphenyl]methoxyamino]phenoxy]phenyl]carbamoyl]-5-hydroxybenzoic acid.
| Compound Name | 2-[[4-[4-[[2-(hydroperoxymethyl)-4-hydroxyphenyl]methoxyamino]phenoxy]phenyl]carbamoyl]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 59936011 |
| Molecular Formula | C28H24N2O9 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 2-[[4-[4-[[2-(hydroperoxymethyl)-4-hydroxyphenyl]methoxyamino]phenoxy]phenyl]carbamoyl]-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)ccc1C(=O)Nc1ccc(Oc2ccc(NOCc3ccc(O)cc3COO)cc2)cc1 |
| InChI | InChI=1S/C28H24N2O9/c31-21-6-1-17(18(13-21)16-38-36)15-37-30-20-4-10-24(11-5-20)39-23-8-2-19(3-9-23)29-27(33)25-12-7-22(32)14-26(25)28(34)35/h1-14,30-32,36H,15-16H2,(H,29,33)(H,34,35) |
| InChIKey | YULNVVCOABTHFN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|