C44H38N2O11 — CID 59936131
4-(benzylperoxymethyl)-2-[[4-[4-[[2-(hydroperoxymethyl)-5-phenylmethoxycarbonylphenyl]methoxyamino]phenoxy]phenyl]carbamoyl]benzoic acid (PubChem CID 59936131) has the molecular formula C44H38N2O11 and a molecular weight of 770.79 g/mol. Its IUPAC name is 4-(benzylperoxymethyl)-2-[[4-[4-[[2-(hydroperoxymethyl)-5-phenylmethoxycarbonylphenyl]methoxyamino]phenoxy]phenyl]carbamoyl]benzoic acid.
| Compound Name | 4-(benzylperoxymethyl)-2-[[4-[4-[[2-(hydroperoxymethyl)-5-phenylmethoxycarbonylphenyl]methoxyamino]phenoxy]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 59936131 |
| Molecular Formula | C44H38N2O11 |
| Molecular Weight | 770.79 g/mol |
| Exact Mass | 770.25 |
| IUPAC Name | 4-(benzylperoxymethyl)-2-[[4-[4-[[2-(hydroperoxymethyl)-5-phenylmethoxycarbonylphenyl]methoxyamino]phenoxy]phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(OCc1ccccc1)c1ccc(COO)c(CONc2ccc(Oc3ccc(NC(=O)c4cc(COOCc5ccccc5)ccc4C(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C44H38N2O11/c47-42(41-23-32(11-22-40(41)43(48)49)27-56-55-26-31-9-5-2-6-10-31)45-36-14-18-38(19-15-36)57-39-20-16-37(17-21-39)46-53-28-35-24-33(12-13-34(35)29-54-51)44(50)52-25-30-7-3-1-4-8-30/h1-24,46,51H,25-29H2,(H,45,47)(H,48,49) |
| InChIKey | LTAQBXPPYZJOPL-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 171.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.79 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|