C21H24N2O10 — CID 59935966
2-[3-[[5-carboxy-2-(hydroperoxymethyl)phenyl]methoxyamino]propylcarbamoyl]-4-(hydroperoxymethyl)benzoic acid (PubChem CID 59935966) has the molecular formula C21H24N2O10 and a molecular weight of 464.43 g/mol. Its IUPAC name is 2-[3-[[5-carboxy-2-(hydroperoxymethyl)phenyl]methoxyamino]propylcarbamoyl]-4-(hydroperoxymethyl)benzoic acid.
| Compound Name | 2-[3-[[5-carboxy-2-(hydroperoxymethyl)phenyl]methoxyamino]propylcarbamoyl]-4-(hydroperoxymethyl)benzoic acid |
|---|---|
| PubChem CID | 59935966 |
| Molecular Formula | C21H24N2O10 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[3-[[5-carboxy-2-(hydroperoxymethyl)phenyl]methoxyamino]propylcarbamoyl]-4-(hydroperoxymethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(COO)c(CONCCCNC(=O)c2cc(COO)ccc2C(=O)O)c1 |
| InChI | InChI=1S/C21H24N2O10/c24-19(18-8-13(10-32-29)2-5-17(18)21(27)28)22-6-1-7-23-31-11-16-9-14(20(25)26)3-4-15(16)12-33-30/h2-5,8-9,23,29-30H,1,6-7,10-12H2,(H,22,24)(H,25,26)(H,27,28) |
| InChIKey | WVMBHSKEVAZHKR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 183.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|