C19H18N4O10 — CID 20733065
2-[[3-[(2-carboxy-5-nitrobenzoyl)amino]propylamino]oxymethyl]-4-nitrobenzoic acid (PubChem CID 20733065) has the molecular formula C19H18N4O10 and a molecular weight of 462.37 g/mol. Its IUPAC name is 2-[[3-[(2-carboxy-5-nitrobenzoyl)amino]propylamino]oxymethyl]-4-nitrobenzoic acid.
| Compound Name | 2-[[3-[(2-carboxy-5-nitrobenzoyl)amino]propylamino]oxymethyl]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 20733065 |
| Molecular Formula | C19H18N4O10 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-[[3-[(2-carboxy-5-nitrobenzoyl)amino]propylamino]oxymethyl]-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1CONCCCNC(=O)c1cc([N+](=O)[O-])ccc1C(=O)O |
| InChI | InChI=1S/C19H18N4O10/c24-17(16-9-13(23(31)32)3-5-15(16)19(27)28)20-6-1-7-21-33-10-11-8-12(22(29)30)2-4-14(11)18(25)26/h2-5,8-9,21H,1,6-7,10H2,(H,20,24)(H,25,26)(H,27,28) |
| InChIKey | WBBZBPADFTWDIP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 211.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|