C17H14N4O10 — CID 20733039
2-[[[(2-carboxy-5-nitrobenzoyl)amino]methylamino]oxymethyl]-4-nitrobenzoic acid (PubChem CID 20733039) has the molecular formula C17H14N4O10 and a molecular weight of 434.32 g/mol. Its IUPAC name is 2-[[[(2-carboxy-5-nitrobenzoyl)amino]methylamino]oxymethyl]-4-nitrobenzoic acid.
| Compound Name | 2-[[[(2-carboxy-5-nitrobenzoyl)amino]methylamino]oxymethyl]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 20733039 |
| Molecular Formula | C17H14N4O10 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-[[[(2-carboxy-5-nitrobenzoyl)amino]methylamino]oxymethyl]-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1CONCNC(=O)c1cc([N+](=O)[O-])ccc1C(=O)O |
| InChI | InChI=1S/C17H14N4O10/c22-15(14-6-11(21(29)30)2-4-13(14)17(25)26)18-8-19-31-7-9-5-10(20(27)28)1-3-12(9)16(23)24/h1-6,19H,7-8H2,(H,18,22)(H,23,24)(H,25,26) |
| InChIKey | UVDLOJLQNPMKRP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 211.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|