C22H16N4O10 — CID 20733128
2-[[4-[(2-carboxy-4-nitrobenzoyl)amino]anilino]oxymethyl]-5-nitrobenzoic acid (PubChem CID 20733128) has the molecular formula C22H16N4O10 and a molecular weight of 496.39 g/mol. Its IUPAC name is 2-[[4-[(2-carboxy-4-nitrobenzoyl)amino]anilino]oxymethyl]-5-nitrobenzoic acid.
| Compound Name | 2-[[4-[(2-carboxy-4-nitrobenzoyl)amino]anilino]oxymethyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 20733128 |
| Molecular Formula | C22H16N4O10 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 2-[[4-[(2-carboxy-4-nitrobenzoyl)amino]anilino]oxymethyl]-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1CONc1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2C(=O)O)cc1 |
| InChI | InChI=1S/C22H16N4O10/c27-20(17-8-7-16(26(34)35)10-19(17)22(30)31)23-13-2-4-14(5-3-13)24-36-11-12-1-6-15(25(32)33)9-18(12)21(28)29/h1-10,24H,11H2,(H,23,27)(H,28,29)(H,30,31) |
| InChIKey | RQXIYMNOBCLYGY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 211.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|