C30H27N3O8 — CID 59935884
2-[[4-[[4-[[2-(hydroperoxymethyl)-5-nitrophenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-4-methylbenzoic acid (PubChem CID 59935884) has the molecular formula C30H27N3O8 and a molecular weight of 557.56 g/mol. Its IUPAC name is 2-[[4-[[4-[[2-(hydroperoxymethyl)-5-nitrophenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-4-methylbenzoic acid.
| Compound Name | 2-[[4-[[4-[[2-(hydroperoxymethyl)-5-nitrophenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 59935884 |
| Molecular Formula | C30H27N3O8 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 2-[[4-[[4-[[2-(hydroperoxymethyl)-5-nitrophenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(C(=O)Nc2ccc(Cc3ccc(NOCc4cc([N+](=O)[O-])ccc4COO)cc3)cc2)c1 |
| InChI | InChI=1S/C30H27N3O8/c1-19-2-13-27(30(35)36)28(14-19)29(34)31-24-8-3-20(4-9-24)15-21-5-10-25(11-6-21)32-40-17-23-16-26(33(37)38)12-7-22(23)18-41-39/h2-14,16,32,39H,15,17-18H2,1H3,(H,31,34)(H,35,36) |
| InChIKey | AGGNSPYCIMXLRL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 160.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|