C29H23NO12S — CID 59935889
2-[4-[4-[[2-(hydroperoxymethyl)-4-nitrophenyl]methylperoxy]phenoxy]sulfinylphenoxy]carbonyl-5-methylbenzoic acid (PubChem CID 59935889) has the molecular formula C29H23NO12S and a molecular weight of 609.57 g/mol. Its IUPAC name is 2-[4-[4-[[2-(hydroperoxymethyl)-4-nitrophenyl]methylperoxy]phenoxy]sulfinylphenoxy]carbonyl-5-methylbenzoic acid.
| Compound Name | 2-[4-[4-[[2-(hydroperoxymethyl)-4-nitrophenyl]methylperoxy]phenoxy]sulfinylphenoxy]carbonyl-5-methylbenzoic acid |
|---|---|
| PubChem CID | 59935889 |
| Molecular Formula | C29H23NO12S |
| Molecular Weight | 609.57 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | 2-[4-[4-[[2-(hydroperoxymethyl)-4-nitrophenyl]methylperoxy]phenoxy]sulfinylphenoxy]carbonyl-5-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)Oc2ccc(S(=O)Oc3ccc(OOCc4ccc([N+](=O)[O-])cc4COO)cc3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C29H23NO12S/c1-18-2-13-26(27(14-18)28(31)32)29(33)40-22-9-11-25(12-10-22)43(37)42-24-7-5-23(6-8-24)41-39-17-19-3-4-21(30(34)35)15-20(19)16-38-36/h2-15,36H,16-17H2,1H3,(H,31,32) |
| InChIKey | WVOJDBOXTKXNRU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 180.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|