C28H19NO12 — CID 20733337
2-[4-[4-[(2-carboxy-4-hydroxyphenyl)methylperoxy]phenoxy]phenoxy]carbonyl-4-nitrobenzoic acid (PubChem CID 20733337) has the molecular formula C28H19NO12 and a molecular weight of 561.46 g/mol. Its IUPAC name is 2-[4-[4-[(2-carboxy-4-hydroxyphenyl)methylperoxy]phenoxy]phenoxy]carbonyl-4-nitrobenzoic acid.
| Compound Name | 2-[4-[4-[(2-carboxy-4-hydroxyphenyl)methylperoxy]phenoxy]phenoxy]carbonyl-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 20733337 |
| Molecular Formula | C28H19NO12 |
| Molecular Weight | 561.46 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | 2-[4-[4-[(2-carboxy-4-hydroxyphenyl)methylperoxy]phenoxy]phenoxy]carbonyl-4-nitrobenzoic acid |
| SMILES | O=C(O)c1cc(O)ccc1COOc1ccc(Oc2ccc(OC(=O)c3cc([N+](=O)[O-])ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H19NO12/c30-18-3-1-16(24(14-18)27(33)34)15-38-41-22-10-8-20(9-11-22)39-19-4-6-21(7-5-19)40-28(35)25-13-17(29(36)37)2-12-23(25)26(31)32/h1-14,30H,15H2,(H,31,32)(H,33,34) |
| InChIKey | VCWZWCVTYDAVNO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 191.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|