C29H21NO11 — CID 20733338
2-[4-[[4-[(2-carboxy-5-hydroxyphenyl)methylperoxy]phenyl]methyl]phenoxy]carbonyl-4-nitrobenzoic acid (PubChem CID 20733338) has the molecular formula C29H21NO11 and a molecular weight of 559.48 g/mol. Its IUPAC name is 2-[4-[[4-[(2-carboxy-5-hydroxyphenyl)methylperoxy]phenyl]methyl]phenoxy]carbonyl-4-nitrobenzoic acid.
| Compound Name | 2-[4-[[4-[(2-carboxy-5-hydroxyphenyl)methylperoxy]phenyl]methyl]phenoxy]carbonyl-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 20733338 |
| Molecular Formula | C29H21NO11 |
| Molecular Weight | 559.48 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 2-[4-[[4-[(2-carboxy-5-hydroxyphenyl)methylperoxy]phenyl]methyl]phenoxy]carbonyl-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc(O)cc1COOc1ccc(Cc2ccc(OC(=O)c3cc([N+](=O)[O-])ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H21NO11/c31-21-6-12-24(27(32)33)19(14-21)16-39-41-23-9-3-18(4-10-23)13-17-1-7-22(8-2-17)40-29(36)26-15-20(30(37)38)5-11-25(26)28(34)35/h1-12,14-15,31H,13,16H2,(H,32,33)(H,34,35) |
| InChIKey | SSZHSVZVAJCYLM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 182.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|