C38H26O12 — CID 161281863
2-[[4-(2-carboxy-5-ethynoxybenzoyl)oxyphenyl]peroxymethyl]-4-(2-phenoxyethynoxy)benzoic acid;phenol (PubChem CID 161281863) has the molecular formula C38H26O12 and a molecular weight of 674.61 g/mol. Its IUPAC name is 2-[[4-(2-carboxy-5-ethynoxybenzoyl)oxyphenyl]peroxymethyl]-4-(2-phenoxyethynoxy)benzoic acid;phenol.
| Compound Name | 2-[[4-(2-carboxy-5-ethynoxybenzoyl)oxyphenyl]peroxymethyl]-4-(2-phenoxyethynoxy)benzoic acid;phenol |
|---|---|
| PubChem CID | 161281863 |
| Molecular Formula | C38H26O12 |
| Molecular Weight | 674.61 g/mol |
| Exact Mass | 674.14 |
| IUPAC Name | 2-[[4-(2-carboxy-5-ethynoxybenzoyl)oxyphenyl]peroxymethyl]-4-(2-phenoxyethynoxy)benzoic acid;phenol |
| SMILES | C#COc1ccc(C(=O)O)c(C(=O)Oc2ccc(OOCc3cc(OC#COc4ccccc4)ccc3C(=O)O)cc2)c1.Oc1ccccc1 |
| InChI | InChI=1S/C32H20O11.C6H6O/c1-2-38-26-13-15-28(31(35)36)29(19-26)32(37)42-23-8-10-24(11-9-23)43-41-20-21-18-25(12-14-27(21)30(33)34)40-17-16-39-22-6-4-3-5-7-22;7-6-4-2-1-3-5-6/h1,3-15,18-19H,20H2,(H,33,34)(H,35,36);1-5,7H |
| InChIKey | VFEVDKWWFZVNIG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|