C28H19NO11 — CID 20733379
2-[4-[4-[(2-carboxyphenyl)methylperoxy]phenoxy]phenoxy]carbonyl-4-nitrobenzoic acid (PubChem CID 20733379) has the molecular formula C28H19NO11 and a molecular weight of 545.46 g/mol. Its IUPAC name is 2-[4-[4-[(2-carboxyphenyl)methylperoxy]phenoxy]phenoxy]carbonyl-4-nitrobenzoic acid.
| Compound Name | 2-[4-[4-[(2-carboxyphenyl)methylperoxy]phenoxy]phenoxy]carbonyl-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 20733379 |
| Molecular Formula | C28H19NO11 |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 2-[4-[4-[(2-carboxyphenyl)methylperoxy]phenoxy]phenoxy]carbonyl-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccccc1COOc1ccc(Oc2ccc(OC(=O)c3cc([N+](=O)[O-])ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H19NO11/c30-26(31)23-4-2-1-3-17(23)16-37-40-22-12-10-20(11-13-22)38-19-6-8-21(9-7-19)39-28(34)25-15-18(29(35)36)5-14-24(25)27(32)33/h1-15H,16H2,(H,30,31)(H,32,33) |
| InChIKey | BGUKDHVTRQXBKU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 171.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|