C55H44O10 — CID 59935848
2-[4-[4-[2-[4-[4-[[2-(hydroperoxymethyl)-4-phenylphenyl]methylperoxy]phenoxy]phenyl]propan-2-yl]phenoxy]phenoxy]carbonyl-5-phenylbenzoic acid (PubChem CID 59935848) has the molecular formula C55H44O10 and a molecular weight of 864.95 g/mol. Its IUPAC name is 2-[4-[4-[2-[4-[4-[[2-(hydroperoxymethyl)-4-phenylphenyl]methylperoxy]phenoxy]phenyl]propan-2-yl]phenoxy]phenoxy]carbonyl-5-phenylbenzoic acid.
| Compound Name | 2-[4-[4-[2-[4-[4-[[2-(hydroperoxymethyl)-4-phenylphenyl]methylperoxy]phenoxy]phenyl]propan-2-yl]phenoxy]phenoxy]carbonyl-5-phenylbenzoic acid |
|---|---|
| PubChem CID | 59935848 |
| Molecular Formula | C55H44O10 |
| Molecular Weight | 864.95 g/mol |
| Exact Mass | 864.29 |
| IUPAC Name | 2-[4-[4-[2-[4-[4-[[2-(hydroperoxymethyl)-4-phenylphenyl]methylperoxy]phenoxy]phenyl]propan-2-yl]phenoxy]phenoxy]carbonyl-5-phenylbenzoic acid |
| SMILES | CC(C)(c1ccc(Oc2ccc(OOCc3ccc(-c4ccccc4)cc3COO)cc2)cc1)c1ccc(Oc2ccc(OC(=O)c3ccc(-c4ccccc4)cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C55H44O10/c1-55(2,43-16-20-45(21-17-43)62-47-24-26-49(27-25-47)64-54(58)51-32-15-40(34-52(51)53(56)57)38-11-7-4-8-12-38)44-18-22-46(23-19-44)63-48-28-30-50(31-29-48)65-61-36-41-14-13-39(33-42(41)35-60-59)37-9-5-3-6-10-37/h3-34,59H,35-36H2,1-2H3,(H,56,57) |
| InChIKey | TZTQEVYTTVIBOK-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.95 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|