C39H28O9S — CID 59936047
2-[4-[4-[2-(hydroperoxymethyl)-4-phenylphenoxy]phenoxy]sulfinylphenoxy]carbonyl-5-phenylbenzoic acid (PubChem CID 59936047) has the molecular formula C39H28O9S and a molecular weight of 672.71 g/mol. Its IUPAC name is 2-[4-[4-[2-(hydroperoxymethyl)-4-phenylphenoxy]phenoxy]sulfinylphenoxy]carbonyl-5-phenylbenzoic acid.
| Compound Name | 2-[4-[4-[2-(hydroperoxymethyl)-4-phenylphenoxy]phenoxy]sulfinylphenoxy]carbonyl-5-phenylbenzoic acid |
|---|---|
| PubChem CID | 59936047 |
| Molecular Formula | C39H28O9S |
| Molecular Weight | 672.71 g/mol |
| Exact Mass | 672.15 |
| IUPAC Name | 2-[4-[4-[2-(hydroperoxymethyl)-4-phenylphenoxy]phenoxy]sulfinylphenoxy]carbonyl-5-phenylbenzoic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2)ccc1C(=O)Oc1ccc(S(=O)Oc2ccc(Oc3ccc(-c4ccccc4)cc3COO)cc2)cc1 |
| InChI | InChI=1S/C39H28O9S/c40-38(41)36-24-29(27-9-5-2-6-10-27)11-21-35(36)39(42)47-32-17-19-34(20-18-32)49(44)48-33-15-13-31(14-16-33)46-37-22-12-28(23-30(37)25-45-43)26-7-3-1-4-8-26/h1-24,43H,25H2,(H,40,41) |
| InChIKey | IXCJRCXASMEUHP-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.71 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|