C41H32O9S — CID 59936039
5-benzyl-2-[3-[3-[4-benzyl-2-(hydroperoxymethyl)phenoxy]phenyl]sulfonylphenoxy]carbonylbenzoic acid (PubChem CID 59936039) has the molecular formula C41H32O9S and a molecular weight of 700.77 g/mol. Its IUPAC name is 5-benzyl-2-[3-[3-[4-benzyl-2-(hydroperoxymethyl)phenoxy]phenyl]sulfonylphenoxy]carbonylbenzoic acid.
| Compound Name | 5-benzyl-2-[3-[3-[4-benzyl-2-(hydroperoxymethyl)phenoxy]phenyl]sulfonylphenoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 59936039 |
| Molecular Formula | C41H32O9S |
| Molecular Weight | 700.77 g/mol |
| Exact Mass | 700.18 |
| IUPAC Name | 5-benzyl-2-[3-[3-[4-benzyl-2-(hydroperoxymethyl)phenoxy]phenyl]sulfonylphenoxy]carbonylbenzoic acid |
| SMILES | O=C(O)c1cc(Cc2ccccc2)ccc1C(=O)Oc1cccc(S(=O)(=O)c2cccc(Oc3ccc(Cc4ccccc4)cc3COO)c2)c1 |
| InChI | InChI=1S/C41H32O9S/c42-40(43)38-24-31(22-29-11-5-2-6-12-29)17-19-37(38)41(44)50-34-14-8-16-36(26-34)51(46,47)35-15-7-13-33(25-35)49-39-20-18-30(23-32(39)27-48-45)21-28-9-3-1-4-10-28/h1-20,23-26,45H,21-22,27H2,(H,42,43) |
| InChIKey | LJTHCOAHYLJSIO-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.77 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|