C43H36O8 — CID 161421951
formaldehyde;2-[4-[2-[4-[2-(hydroperoxymethyl)-4-phenylphenoxy]phenyl]propan-2-yl]phenoxy]carbonyl-5-phenylbenzoic acid (PubChem CID 161421951) has the molecular formula C43H36O8 and a molecular weight of 680.75 g/mol. Its IUPAC name is formaldehyde;2-[4-[2-[4-[2-(hydroperoxymethyl)-4-phenylphenoxy]phenyl]propan-2-yl]phenoxy]carbonyl-5-phenylbenzoic acid.
| Compound Name | formaldehyde;2-[4-[2-[4-[2-(hydroperoxymethyl)-4-phenylphenoxy]phenyl]propan-2-yl]phenoxy]carbonyl-5-phenylbenzoic acid |
|---|---|
| PubChem CID | 161421951 |
| Molecular Formula | C43H36O8 |
| Molecular Weight | 680.75 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | formaldehyde;2-[4-[2-[4-[2-(hydroperoxymethyl)-4-phenylphenoxy]phenyl]propan-2-yl]phenoxy]carbonyl-5-phenylbenzoic acid |
| SMILES | C=O.CC(C)(c1ccc(OC(=O)c2ccc(-c3ccccc3)cc2C(=O)O)cc1)c1ccc(Oc2ccc(-c3ccccc3)cc2COO)cc1 |
| InChI | InChI=1S/C42H34O7.CH2O/c1-42(2,33-15-19-35(20-16-33)48-39-24-14-30(25-32(39)27-47-46)28-9-5-3-6-10-28)34-17-21-36(22-18-34)49-41(45)37-23-13-31(26-38(37)40(43)44)29-11-7-4-8-12-29;1-2/h3-26,46H,27H2,1-2H3,(H,43,44);1H2 |
| InChIKey | VWVRXQMCRDAXFM-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.75 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|